C32H53N5O6 — CID 142241129
tert-butyl N-[(2S)-4-amino-1-[[(4S,7R)-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-2,5,7-trimethyl-8-oxooctan-4-yl]amino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 142241129) has the molecular formula C32H53N5O6 and a molecular weight of 603.81 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-amino-1-[[(4S,7R)-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-2,5,7-trimethyl-8-oxooctan-4-yl]amino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-amino-1-[[(4S,7R)-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-2,5,7-trimethyl-8-oxooctan-4-yl]amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142241129 |
| Molecular Formula | C32H53N5O6 |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 603.40 |
| IUPAC Name | tert-butyl N-[(2S)-4-amino-1-[[(4S,7R)-8-[[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino]-2,5,7-trimethyl-8-oxooctan-4-yl]amino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)OC(C)(C)C)C(C)C[C@@H](C)C(=O)N[C@H](C(=O)NCc1ccccc1)C(C)C |
| InChI | InChI=1S/C32H53N5O6/c1-19(2)15-24(35-29(40)25(17-26(33)38)36-31(42)43-32(7,8)9)21(5)16-22(6)28(39)37-27(20(3)4)30(41)34-18-23-13-11-10-12-14-23/h10-14,19-22,24-25,27H,15-18H2,1-9H3,(H2,33,38)(H,34,41)(H,35,40)(H,36,42)(H,37,39)/t21?,22-,24+,25+,27+/m1/s1 |
| InChIKey | WYRQZNJICGNKFE-RJMOJKAZSA-N |
| XLogP | 3.41 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |