C21H22N6O4S — CID 67589331
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-phenyl-1,3-thiazol-2-yl)ethylamino]purin-9-yl]oxolane-3,4-diol (PubChem CID 67589331) has the molecular formula C21H22N6O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-phenyl-1,3-thiazol-2-yl)ethylamino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-phenyl-1,3-thiazol-2-yl)ethylamino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67589331 |
| Molecular Formula | C21H22N6O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[2-(4-phenyl-1,3-thiazol-2-yl)ethylamino]purin-9-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCCc4nc(-c5ccccc5)cs4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H22N6O4S/c28-8-14-17(29)18(30)21(31-14)27-11-25-16-19(23-10-24-20(16)27)22-7-6-15-26-13(9-32-15)12-4-2-1-3-5-12/h1-5,9-11,14,17-18,21,28-30H,6-8H2,(H,22,23,24)/t14-,17-,18-,21-/m1/s1 |
| InChIKey | FOSCVWNRLHBDTD-HAXDFEGKSA-N |
| XLogP | 1.22 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |