C16H11N3O — CID 67591615
(3E)-3-(1H-pyrrolo[3,2-b]pyridin-3-ylmethylidene)-1H-indol-2-one (PubChem CID 67591615) has the molecular formula C16H11N3O and a molecular weight of 261.28 g/mol. Its IUPAC name is (3E)-3-(1H-pyrrolo[3,2-b]pyridin-3-ylmethylidene)-1H-indol-2-one.
| Compound Name | (3E)-3-(1H-pyrrolo[3,2-b]pyridin-3-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 67591615 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (3E)-3-(1H-pyrrolo[3,2-b]pyridin-3-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C\c1c[nH]c2cccnc12 |
| InChI | InChI=1S/C16H11N3O/c20-16-12(11-4-1-2-5-13(11)19-16)8-10-9-18-14-6-3-7-17-15(10)14/h1-9,18H,(H,19,20)/b12-8+ |
| InChIKey | GDPMLGVDIZTPFH-XYOKQWHBSA-N |
| XLogP | 3.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|