C24H18N2O2 — CID 11164464
(3E)-3-[(5-phenylmethoxy-1H-indol-3-yl)methylidene]-1H-indol-2-one (PubChem CID 11164464) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is (3E)-3-[(5-phenylmethoxy-1H-indol-3-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[(5-phenylmethoxy-1H-indol-3-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 11164464 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (3E)-3-[(5-phenylmethoxy-1H-indol-3-yl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C\c1c[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C24H18N2O2/c27-24-21(19-8-4-5-9-23(19)26-24)12-17-14-25-22-11-10-18(13-20(17)22)28-15-16-6-2-1-3-7-16/h1-14,25H,15H2,(H,26,27)/b21-12+ |
| InChIKey | HLYUXWGNIFUKHX-CIAFOILYSA-N |
| XLogP | 5.24 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|