C6H10N2O — CID 67592208
3-Ethyl-1,6-dihydropyrimidin-2-one (PubChem CID 67592208) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is 3-ethyl-1,6-dihydropyrimidin-2-one.
| Compound Name | 3-Ethyl-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 67592208 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 3-ethyl-1,6-dihydropyrimidin-2-one |
| SMILES | CCN1C=CCNC1=O |
| InChI | InChI=1S/C6H10N2O/c1-2-8-5-3-4-7-6(8)9/h3,5H,2,4H2,1H3,(H,7,9) |
| InChIKey | FGFYKZKVCJDYKY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | 142 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |