C13H30N2O3P+ — CID 67593642
3-(2-ethoxy-4-methyl-1,3,2-dioxaphosphetan-4-yl)propyl-dimethyl-[3-(methylamino)propyl]azanium (PubChem CID 67593642) has the molecular formula C13H30N2O3P+ and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-(2-ethoxy-4-methyl-1,3,2-dioxaphosphetan-4-yl)propyl-dimethyl-[3-(methylamino)propyl]azanium.
| Compound Name | 3-(2-ethoxy-4-methyl-1,3,2-dioxaphosphetan-4-yl)propyl-dimethyl-[3-(methylamino)propyl]azanium |
|---|---|
| PubChem CID | 67593642 |
| Molecular Formula | C13H30N2O3P+ |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 3-(2-ethoxy-4-methyl-1,3,2-dioxaphosphetan-4-yl)propyl-dimethyl-[3-(methylamino)propyl]azanium |
| SMILES | CCOP1OC(C)(CCC[N+](C)(C)CCCNC)O1 |
| InChI | InChI=1S/C13H30N2O3P/c1-6-16-19-17-13(2,18-19)9-7-11-15(4,5)12-8-10-14-3/h14H,6-12H2,1-5H3/q+1 |
| InChIKey | KNOGOTLUELLAAW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|