C7H14O5P2 — CID 88915075
3-ethoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 88915075) has the molecular formula C7H14O5P2 and a molecular weight of 240.13 g/mol. Its IUPAC name is 3-ethoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3-ethoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 88915075 |
| Molecular Formula | C7H14O5P2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 3-ethoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CCOP1OCC2(COPOC2)CO1 |
| InChI | InChI=1S/C7H14O5P2/c1-2-10-14-11-5-7(6-12-14)3-8-13-9-4-7/h13H,2-6H2,1H3 |
| InChIKey | JFUXWZJPCZDYAA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|