C18H16F3N3O3 — CID 67593914
3-amino-N-[[3-[5-hydroxy-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]benzamide (PubChem CID 67593914) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is 3-amino-N-[[3-[5-hydroxy-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]benzamide.
| Compound Name | 3-amino-N-[[3-[5-hydroxy-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 67593914 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-amino-N-[[3-[5-hydroxy-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]benzamide |
| SMILES | Nc1cccc(C(=O)NCc2cccc(C3=NOC(O)(C(F)(F)F)C3)c2)c1 |
| InChI | InChI=1S/C18H16F3N3O3/c19-18(20,21)17(26)9-15(24-27-17)12-4-1-3-11(7-12)10-23-16(25)13-5-2-6-14(22)8-13/h1-8,26H,9-10,22H2,(H,23,25) |
| InChIKey | VFWPWCBZYBRVSV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|