C11H17NO5S — CID 67595409
furan-3-carbonyl(hexyl)sulfamic acid (PubChem CID 67595409) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is furan-3-carbonyl(hexyl)sulfamic acid.
| Compound Name | furan-3-carbonyl(hexyl)sulfamic acid |
|---|---|
| PubChem CID | 67595409 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | furan-3-carbonyl(hexyl)sulfamic acid |
| SMILES | CCCCCCN(C(=O)c1ccoc1)S(=O)(=O)O |
| InChI | InChI=1S/C11H17NO5S/c1-2-3-4-5-7-12(18(14,15)16)11(13)10-6-8-17-9-10/h6,8-9H,2-5,7H2,1H3,(H,14,15,16) |
| InChIKey | IXUYTOUGRGRFBE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|