C18H32N3O3+ — CID 7218508
2-[3-[furan-3-carbonyl(hexyl)amino]propanoylamino]ethyl-dimethylazanium (PubChem CID 7218508) has the molecular formula C18H32N3O3+ and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-[3-[furan-3-carbonyl(hexyl)amino]propanoylamino]ethyl-dimethylazanium.
| Compound Name | 2-[3-[furan-3-carbonyl(hexyl)amino]propanoylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7218508 |
| Molecular Formula | C18H32N3O3+ |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2-[3-[furan-3-carbonyl(hexyl)amino]propanoylamino]ethyl-dimethylazanium |
| SMILES | CCCCCCN(CCC(=O)NCC[NH+](C)C)C(=O)c1ccoc1 |
| InChI | InChI=1S/C18H31N3O3/c1-4-5-6-7-11-21(18(23)16-9-14-24-15-16)12-8-17(22)19-10-13-20(2)3/h9,14-15H,4-8,10-13H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | JDJOKAMCONIHRH-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|