C26H33NO7 — CID 67597547
1-[4-(1-bicyclo[2.2.2]octanylmethoxy)phenoxy]-4-pyridin-3-ylbutan-2-ol;oxalic acid (PubChem CID 67597547) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is 1-[4-(1-bicyclo[2.2.2]octanylmethoxy)phenoxy]-4-pyridin-3-ylbutan-2-ol;oxalic acid.
| Compound Name | 1-[4-(1-bicyclo[2.2.2]octanylmethoxy)phenoxy]-4-pyridin-3-ylbutan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 67597547 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 1-[4-(1-bicyclo[2.2.2]octanylmethoxy)phenoxy]-4-pyridin-3-ylbutan-2-ol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OC(CCc1cccnc1)COc1ccc(OCC23CCC(CC2)CC3)cc1 |
| InChI | InChI=1S/C24H31NO3.C2H2O4/c26-21(4-3-20-2-1-15-25-16-20)17-27-22-5-7-23(8-6-22)28-18-24-12-9-19(10-13-24)11-14-24;3-1(4)2(5)6/h1-2,5-8,15-16,19,21,26H,3-4,9-14,17-18H2;(H,3,4)(H,5,6) |
| InChIKey | YYYMPCAUKKLCJC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|