About 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol
2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol (PubChem CID 67598519) has the molecular formula C9H8Cl2S4
and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol.
Molecular Properties
| Compound Name | 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol |
| PubChem CID | 67598519 |
| Molecular Formula | C9H8Cl2S4 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 313.89 |
| IUPAC Name | 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol |
| SMILES | ClC(Cl)Sc1cccs1.Sc1cccs1 |
| InChI | InChI=1S/C5H4Cl2S2.C4H4S2/c6-5(7)9-4-2-1-3-8-4;5-4-2-1-3-6-4/h1-3,5H;1-3,5H |
| InChIKey | BVXUWDAWVWKMJX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol?
The IUPAC name of 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol (CID 67598519) is 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol.
What is the SMILES notation for 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol?
The canonical SMILES for 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol is ClC(Cl)Sc1cccs1.Sc1cccs1.
What is the InChIKey of 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol?
The InChIKey is BVXUWDAWVWKMJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl2S2.C4H4S2/c6-5(7)9-4-2-1-3-8-4;5-4-2-1-3-6-4/h1-3,5H;1-3,5H.
What are the key properties of 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol?
2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol has a molecular weight of 315.34 g/mol, XLogP of 5.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloromethylsulfanyl)thiophene;thiophene-2-thiol is sourced from PubChem (CID 67598519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).