C24H29NO4 — CID 67598558
(3S,4S)-4-[1-(9H-fluoren-9-ylmethoxy)ethenylamino]-3-hydroxy-6-methylheptanoic acid (PubChem CID 67598558) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3S,4S)-4-[1-(9H-fluoren-9-ylmethoxy)ethenylamino]-3-hydroxy-6-methylheptanoic acid.
| Compound Name | (3S,4S)-4-[1-(9H-fluoren-9-ylmethoxy)ethenylamino]-3-hydroxy-6-methylheptanoic acid |
|---|---|
| PubChem CID | 67598558 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (3S,4S)-4-[1-(9H-fluoren-9-ylmethoxy)ethenylamino]-3-hydroxy-6-methylheptanoic acid |
| SMILES | C=C(N[C@@H](CC(C)C)[C@@H](O)CC(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H29NO4/c1-15(2)12-22(23(26)13-24(27)28)25-16(3)29-14-21-19-10-6-4-8-17(19)18-9-5-7-11-20(18)21/h4-11,15,21-23,25-26H,3,12-14H2,1-2H3,(H,27,28)/t22-,23-/m0/s1 |
| InChIKey | NIFZIBVLCCRKHM-GOTSBHOMSA-N |
| XLogP | 4.13 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|