C27H27F6NO5 — CID 101098598
1,1,1,3,3,3-hexafluoropropan-2-yl (3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-6-methyl-2-methylideneheptanoate (PubChem CID 101098598) has the molecular formula C27H27F6NO5 and a molecular weight of 559.50 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-6-methyl-2-methylideneheptanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-6-methyl-2-methylideneheptanoate |
|---|---|
| PubChem CID | 101098598 |
| Molecular Formula | C27H27F6NO5 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (3S,4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-6-methyl-2-methylideneheptanoate |
| SMILES | C=C(C(=O)OC(C(F)(F)F)C(F)(F)F)[C@H](O)[C@H](CC(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H27F6NO5/c1-14(2)12-21(22(35)15(3)23(36)39-24(26(28,29)30)27(31,32)33)34-25(37)38-13-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h4-11,14,20-22,24,35H,3,12-13H2,1-2H3,(H,34,37)/t21-,22-/m0/s1 |
| InChIKey | DBPWZBMBAXDXTH-VXKWHMMOSA-N |
| XLogP | 5.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|