C18H33N5O3 — CID 67598648
1-ethyl-2-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]piperidine-4-carboxylic acid (PubChem CID 67598648) has the molecular formula C18H33N5O3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-ethyl-2-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]piperidine-4-carboxylic acid.
| Compound Name | 1-ethyl-2-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 67598648 |
| Molecular Formula | C18H33N5O3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 1-ethyl-2-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]piperidine-4-carboxylic acid |
| SMILES | CCN1CCC(C(=O)O)CC1NC(=O)N1CCN(C2CCNCC2)CC1 |
| InChI | InChI=1S/C18H33N5O3/c1-2-21-8-5-14(17(24)25)13-16(21)20-18(26)23-11-9-22(10-12-23)15-3-6-19-7-4-15/h14-16,19H,2-13H2,1H3,(H,20,26)(H,24,25) |
| InChIKey | XNQAYDOEHNIOLX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |