C17H10Cl4O — CID 67600792
(1E,4E)-1,5-bis(3,5-dichlorophenyl)penta-1,4-dien-3-one (PubChem CID 67600792) has the molecular formula C17H10Cl4O and a molecular weight of 372.08 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(3,5-dichlorophenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(3,5-dichlorophenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 67600792 |
| Molecular Formula | C17H10Cl4O |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | (1E,4E)-1,5-bis(3,5-dichlorophenyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1cc(Cl)cc(Cl)c1)/C=C/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H10Cl4O/c18-13-5-11(6-14(19)9-13)1-3-17(22)4-2-12-7-15(20)10-16(21)8-12/h1-10H/b3-1+,4-2+ |
| InChIKey | LAIINKPYUYMBSM-ZPUQHVIOSA-N |
| XLogP | 6.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|