C12H13Cl2NO3 — CID 79675580
(E)-3-(3,5-dichlorophenyl)-N-(2-methoxyethoxy)prop-2-enamide (PubChem CID 79675580) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-N-(2-methoxyethoxy)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichlorophenyl)-N-(2-methoxyethoxy)prop-2-enamide |
|---|---|
| PubChem CID | 79675580 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-N-(2-methoxyethoxy)prop-2-enamide |
| SMILES | COCCONC(=O)/C=C/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO3/c1-17-4-5-18-15-12(16)3-2-9-6-10(13)8-11(14)7-9/h2-3,6-8H,4-5H2,1H3,(H,15,16)/b3-2+ |
| InChIKey | ZPILISCYFZATJQ-NSCUHMNNSA-N |
| XLogP | 2.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|