C16H19ClO5S — CID 67601239
(2Z)-1-(2-chloro-4-methylsulfonylphenyl)-2-(ethoxymethylidene)-4-methylpentane-1,3-dione (PubChem CID 67601239) has the molecular formula C16H19ClO5S and a molecular weight of 358.84 g/mol. Its IUPAC name is (2Z)-1-(2-chloro-4-methylsulfonylphenyl)-2-(ethoxymethylidene)-4-methylpentane-1,3-dione.
| Compound Name | (2Z)-1-(2-chloro-4-methylsulfonylphenyl)-2-(ethoxymethylidene)-4-methylpentane-1,3-dione |
|---|---|
| PubChem CID | 67601239 |
| Molecular Formula | C16H19ClO5S |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (2Z)-1-(2-chloro-4-methylsulfonylphenyl)-2-(ethoxymethylidene)-4-methylpentane-1,3-dione |
| SMILES | CCO/C=C(\C(=O)c1ccc(S(C)(=O)=O)cc1Cl)C(=O)C(C)C |
| InChI | InChI=1S/C16H19ClO5S/c1-5-22-9-13(15(18)10(2)3)16(19)12-7-6-11(8-14(12)17)23(4,20)21/h6-10H,5H2,1-4H3/b13-9- |
| InChIKey | CTPGFXRWEVOSFJ-LCYFTJDESA-N |
| XLogP | 3.07 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|