C19H34N4O5 — CID 67603312
(3S)-3-amino-5-(aminomethyl)-7-[ethyl(4-piperidin-4-ylbutanoyl)amino]-4,6-dioxoheptanoic acid (PubChem CID 67603312) has the molecular formula C19H34N4O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (3S)-3-amino-5-(aminomethyl)-7-[ethyl(4-piperidin-4-ylbutanoyl)amino]-4,6-dioxoheptanoic acid.
| Compound Name | (3S)-3-amino-5-(aminomethyl)-7-[ethyl(4-piperidin-4-ylbutanoyl)amino]-4,6-dioxoheptanoic acid |
|---|---|
| PubChem CID | 67603312 |
| Molecular Formula | C19H34N4O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (3S)-3-amino-5-(aminomethyl)-7-[ethyl(4-piperidin-4-ylbutanoyl)amino]-4,6-dioxoheptanoic acid |
| SMILES | CCN(CC(=O)C(CN)C(=O)[C@@H](N)CC(=O)O)C(=O)CCCC1CCNCC1 |
| InChI | InChI=1S/C19H34N4O5/c1-2-23(17(25)5-3-4-13-6-8-22-9-7-13)12-16(24)14(11-20)19(28)15(21)10-18(26)27/h13-15,22H,2-12,20-21H2,1H3,(H,26,27)/t14?,15-/m0/s1 |
| InChIKey | DEHKLDZCZHAMKS-LOACHALJSA-N |
| XLogP | -0.48 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|