C27H46N4O7 — CID 70210208
(4S)-4-amino-2-(2-cyclohexylethyl)-2-[[2-[ethyl(4-piperidin-4-ylbutanoyl)amino]acetyl]amino]-3-oxohexanedioic acid (PubChem CID 70210208) has the molecular formula C27H46N4O7 and a molecular weight of 538.69 g/mol. Its IUPAC name is (4S)-4-amino-2-(2-cyclohexylethyl)-2-[[2-[ethyl(4-piperidin-4-ylbutanoyl)amino]acetyl]amino]-3-oxohexanedioic acid.
| Compound Name | (4S)-4-amino-2-(2-cyclohexylethyl)-2-[[2-[ethyl(4-piperidin-4-ylbutanoyl)amino]acetyl]amino]-3-oxohexanedioic acid |
|---|---|
| PubChem CID | 70210208 |
| Molecular Formula | C27H46N4O7 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | (4S)-4-amino-2-(2-cyclohexylethyl)-2-[[2-[ethyl(4-piperidin-4-ylbutanoyl)amino]acetyl]amino]-3-oxohexanedioic acid |
| SMILES | CCN(CC(=O)NC(CCC1CCCCC1)(C(=O)O)C(=O)[C@@H](N)CC(=O)O)C(=O)CCCC1CCNCC1 |
| InChI | InChI=1S/C27H46N4O7/c1-2-31(23(33)10-6-9-20-12-15-29-16-13-20)18-22(32)30-27(26(37)38,25(36)21(28)17-24(34)35)14-11-19-7-4-3-5-8-19/h19-21,29H,2-18,28H2,1H3,(H,30,32)(H,34,35)(H,37,38)/t21-,27?/m0/s1 |
| InChIKey | SSIVSGVWKCGSLH-LWAJAQLZSA-N |
| XLogP | 1.68 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|