C19H16FNO2 — CID 67603952
3-[3-(3-fluorophenyl)-2-methylquinolin-5-yl]propanoic acid (PubChem CID 67603952) has the molecular formula C19H16FNO2 and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-[3-(3-fluorophenyl)-2-methylquinolin-5-yl]propanoic acid.
| Compound Name | 3-[3-(3-fluorophenyl)-2-methylquinolin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 67603952 |
| Molecular Formula | C19H16FNO2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-[3-(3-fluorophenyl)-2-methylquinolin-5-yl]propanoic acid |
| SMILES | Cc1nc2cccc(CCC(=O)O)c2cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H16FNO2/c1-12-16(14-5-2-6-15(20)10-14)11-17-13(8-9-19(22)23)4-3-7-18(17)21-12/h2-7,10-11H,8-9H2,1H3,(H,22,23) |
| InChIKey | LRKIVJYROANENV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |