C17H22F2N2O3 — CID 67606456
tert-butyl 6-(3,4-difluorophenoxy)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 67606456) has the molecular formula C17H22F2N2O3 and a molecular weight of 340.37 g/mol. Its IUPAC name is tert-butyl 6-(3,4-difluorophenoxy)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 6-(3,4-difluorophenoxy)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 67606456 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | tert-butyl 6-(3,4-difluorophenoxy)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccc(F)c(F)c2)C2NCCC21 |
| InChI | InChI=1S/C17H22F2N2O3/c1-17(2,3)24-16(22)21-9-14(15-13(21)6-7-20-15)23-10-4-5-11(18)12(19)8-10/h4-5,8,13-15,20H,6-7,9H2,1-3H3 |
| InChIKey | URVWABPAAMHCOX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |