C25H26FN5O4 — CID 67606601
[(3aR,6aS)-2-[5-(4-fluorophenyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl-[(3-carbamoyl-1,2-oxazol-5-yl)methyl]carbamic acid (PubChem CID 67606601) has the molecular formula C25H26FN5O4 and a molecular weight of 479.51 g/mol. Its IUPAC name is [(3aR,6aS)-2-[5-(4-fluorophenyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl-[(3-carbamoyl-1,2-oxazol-5-yl)methyl]carbamic acid.
| Compound Name | [(3aR,6aS)-2-[5-(4-fluorophenyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl-[(3-carbamoyl-1,2-oxazol-5-yl)methyl]carbamic acid |
|---|---|
| PubChem CID | 67606601 |
| Molecular Formula | C25H26FN5O4 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | [(3aR,6aS)-2-[5-(4-fluorophenyl)-2-pyridinyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl-[(3-carbamoyl-1,2-oxazol-5-yl)methyl]carbamic acid |
| SMILES | NC(=O)c1cc(CN(CC2C[C@@H]3CN(c4ccc(-c5ccc(F)cc5)cn4)C[C@@H]3C2)C(=O)O)on1 |
| InChI | InChI=1S/C25H26FN5O4/c26-20-4-1-16(2-5-20)17-3-6-23(28-10-17)30-12-18-7-15(8-19(18)13-30)11-31(25(33)34)14-21-9-22(24(27)32)29-35-21/h1-6,9-10,15,18-19H,7-8,11-14H2,(H2,27,32)(H,33,34)/t15?,18-,19+ |
| InChIKey | SSPWFMUMXNCDCK-QNBRMCRTSA-N |
| XLogP | 3.62 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |