C21H24FN3O3 — CID 58032759
(2-amino-2-oxoethyl) 3-[1-[5-(4-fluorophenyl)-2-pyridinyl]piperidin-4-yl]propanoate (PubChem CID 58032759) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-[1-[5-(4-fluorophenyl)-2-pyridinyl]piperidin-4-yl]propanoate.
| Compound Name | (2-amino-2-oxoethyl) 3-[1-[5-(4-fluorophenyl)-2-pyridinyl]piperidin-4-yl]propanoate |
|---|---|
| PubChem CID | 58032759 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-[1-[5-(4-fluorophenyl)-2-pyridinyl]piperidin-4-yl]propanoate |
| SMILES | NC(=O)COC(=O)CCC1CCN(c2ccc(-c3ccc(F)cc3)cn2)CC1 |
| InChI | InChI=1S/C21H24FN3O3/c22-18-5-2-16(3-6-18)17-4-7-20(24-13-17)25-11-9-15(10-12-25)1-8-21(27)28-14-19(23)26/h2-7,13,15H,1,8-12,14H2,(H2,23,26) |
| InChIKey | NJSVWSJSEBZCPG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |