C20H24N4O3 — CID 58032701
(2-amino-2-oxoethyl) 3-[1-(4-phenylpyrimidin-2-yl)piperidin-4-yl]propanoate (PubChem CID 58032701) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-[1-(4-phenylpyrimidin-2-yl)piperidin-4-yl]propanoate.
| Compound Name | (2-amino-2-oxoethyl) 3-[1-(4-phenylpyrimidin-2-yl)piperidin-4-yl]propanoate |
|---|---|
| PubChem CID | 58032701 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-[1-(4-phenylpyrimidin-2-yl)piperidin-4-yl]propanoate |
| SMILES | NC(=O)COC(=O)CCC1CCN(c2nccc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C20H24N4O3/c21-18(25)14-27-19(26)7-6-15-9-12-24(13-10-15)20-22-11-8-17(23-20)16-4-2-1-3-5-16/h1-5,8,11,15H,6-7,9-10,12-14H2,(H2,21,25) |
| InChIKey | OJCNSEOCUNUAGM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |