C21H26N4O3 — CID 68573837
(2-amino-2-oxoethyl) N-[2-[1-(4-phenyl-2-pyridinyl)piperidin-4-yl]ethyl]carbamate (PubChem CID 68573837) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) N-[2-[1-(4-phenyl-2-pyridinyl)piperidin-4-yl]ethyl]carbamate.
| Compound Name | (2-amino-2-oxoethyl) N-[2-[1-(4-phenyl-2-pyridinyl)piperidin-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 68573837 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2-amino-2-oxoethyl) N-[2-[1-(4-phenyl-2-pyridinyl)piperidin-4-yl]ethyl]carbamate |
| SMILES | NC(=O)COC(=O)NCCC1CCN(c2cc(-c3ccccc3)ccn2)CC1 |
| InChI | InChI=1S/C21H26N4O3/c22-19(26)15-28-21(27)24-10-6-16-8-12-25(13-9-16)20-14-18(7-11-23-20)17-4-2-1-3-5-17/h1-5,7,11,14,16H,6,8-10,12-13,15H2,(H2,22,26)(H,24,27) |
| InChIKey | AKABIKXTNAKLIS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |