C15H22N4O3 — CID 68574049
(2-amino-2-oxoethyl) N-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]carbamate (PubChem CID 68574049) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) N-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]carbamate.
| Compound Name | (2-amino-2-oxoethyl) N-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 68574049 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2-amino-2-oxoethyl) N-[[1-(5-methyl-2-pyridinyl)piperidin-4-yl]methyl]carbamate |
| SMILES | Cc1ccc(N2CCC(CNC(=O)OCC(N)=O)CC2)nc1 |
| InChI | InChI=1S/C15H22N4O3/c1-11-2-3-14(17-8-11)19-6-4-12(5-7-19)9-18-15(21)22-10-13(16)20/h2-3,8,12H,4-7,9-10H2,1H3,(H2,16,20)(H,18,21) |
| InChIKey | YCRDTFNMAUPLPO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |