About (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate
(2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate (PubChem CID 68575186) has the molecular formula C12H18N4O3S
and a molecular weight of 298.37 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate |
| PubChem CID | 68575186 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate |
| SMILES | NC(=O)COC(=O)NCC1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C12H18N4O3S/c13-10(17)8-19-12(18)15-7-9-1-4-16(5-2-9)11-14-3-6-20-11/h3,6,9H,1-2,4-5,7-8H2,(H2,13,17)(H,15,18) |
| InChIKey | PBILWLNLDFIQPY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate?
The IUPAC name of (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate (CID 68575186) is (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate.
What is the SMILES notation for (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate?
The canonical SMILES for (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate is NC(=O)COC(=O)NCC1CCN(c2nccs2)CC1.
What is the InChIKey of (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate?
The InChIKey is PBILWLNLDFIQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O3S/c13-10(17)8-19-12(18)15-7-9-1-4-16(5-2-9)11-14-3-6-20-11/h3,6,9H,1-2,4-5,7-8H2,(H2,13,17)(H,15,18).
What are the key properties of (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate?
(2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate has a molecular weight of 298.37 g/mol, XLogP of 0.57, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) N-[[1-(1,3-thiazol-2-yl)piperidin-4-yl]methyl]carbamate is sourced from PubChem (CID 68575186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).