C10H17N3O2S — CID 22243051
N-methylformamide;1-(1,3-thiazol-2-yl)piperidin-4-ol (PubChem CID 22243051) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-methylformamide;1-(1,3-thiazol-2-yl)piperidin-4-ol.
| Compound Name | N-methylformamide;1-(1,3-thiazol-2-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 22243051 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-methylformamide;1-(1,3-thiazol-2-yl)piperidin-4-ol |
| SMILES | CNC=O.OC1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C8H12N2OS.C2H5NO/c11-7-1-4-10(5-2-7)8-9-3-6-12-8;1-3-2-4/h3,6-7,11H,1-2,4-5H2;2H,1H3,(H,3,4) |
| InChIKey | RZEVTYJZAYDMGY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|