C16H22BrN3O3 — CID 58032757
(2-amino-2-oxoethyl) 4-[1-(6-bromo-2-pyridinyl)piperidin-4-yl]butanoate (PubChem CID 58032757) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-[1-(6-bromo-2-pyridinyl)piperidin-4-yl]butanoate.
| Compound Name | (2-amino-2-oxoethyl) 4-[1-(6-bromo-2-pyridinyl)piperidin-4-yl]butanoate |
|---|---|
| PubChem CID | 58032757 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-[1-(6-bromo-2-pyridinyl)piperidin-4-yl]butanoate |
| SMILES | NC(=O)COC(=O)CCCC1CCN(c2cccc(Br)n2)CC1 |
| InChI | InChI=1S/C16H22BrN3O3/c17-13-4-2-5-15(19-13)20-9-7-12(8-10-20)3-1-6-16(22)23-11-14(18)21/h2,4-5,12H,1,3,6-11H2,(H2,18,21) |
| InChIKey | VYYHIIAEZNBUCH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|