C21H27N3O3 — CID 58032707
[2-(methylamino)-2-oxoethyl] 4-(1-isoquinolin-3-ylpiperidin-4-yl)butanoate (PubChem CID 58032707) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-(1-isoquinolin-3-ylpiperidin-4-yl)butanoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-(1-isoquinolin-3-ylpiperidin-4-yl)butanoate |
|---|---|
| PubChem CID | 58032707 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-(1-isoquinolin-3-ylpiperidin-4-yl)butanoate |
| SMILES | CNC(=O)COC(=O)CCCC1CCN(c2cc3ccccc3cn2)CC1 |
| InChI | InChI=1S/C21H27N3O3/c1-22-20(25)15-27-21(26)8-4-5-16-9-11-24(12-10-16)19-13-17-6-2-3-7-18(17)14-23-19/h2-3,6-7,13-14,16H,4-5,8-12,15H2,1H3,(H,22,25) |
| InChIKey | BJBUFZPEMNGCKA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |