C21H25N3O4S — CID 67609687
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-thiazol-2-yl)propanoic acid;naphthalen-2-amine (PubChem CID 67609687) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-thiazol-2-yl)propanoic acid;naphthalen-2-amine.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-thiazol-2-yl)propanoic acid;naphthalen-2-amine |
|---|---|
| PubChem CID | 67609687 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-thiazol-2-yl)propanoic acid;naphthalen-2-amine |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1nccs1)C(=O)O.Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H16N2O4S.C10H9N/c1-11(2,3)17-10(16)13-7(9(14)15)6-8-12-4-5-18-8;11-10-6-5-8-3-1-2-4-9(8)7-10/h4-5,7H,6H2,1-3H3,(H,13,16)(H,14,15);1-7H,11H2/t7-;/m0./s1 |
| InChIKey | OJJPFLXFAJBJNJ-FJXQXJEOSA-N |
| XLogP | 4.09 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|