C17H17ClN2O6S2 — CID 67612233
2-[2-[(4-chloro-3-nitrophenyl)sulfonylamino]ethylsulfanyl]-2-phenylpropanoic acid (PubChem CID 67612233) has the molecular formula C17H17ClN2O6S2 and a molecular weight of 444.92 g/mol. Its IUPAC name is 2-[2-[(4-chloro-3-nitrophenyl)sulfonylamino]ethylsulfanyl]-2-phenylpropanoic acid.
| Compound Name | 2-[2-[(4-chloro-3-nitrophenyl)sulfonylamino]ethylsulfanyl]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 67612233 |
| Molecular Formula | C17H17ClN2O6S2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 2-[2-[(4-chloro-3-nitrophenyl)sulfonylamino]ethylsulfanyl]-2-phenylpropanoic acid |
| SMILES | CC(SCCNS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H17ClN2O6S2/c1-17(16(21)22,12-5-3-2-4-6-12)27-10-9-19-28(25,26)13-7-8-14(18)15(11-13)20(23)24/h2-8,11,19H,9-10H2,1H3,(H,21,22) |
| InChIKey | IXUITJQAWNRZSN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|