C8H14O2 — CID 67615221
5,5-dimethylcyclohexene-1,3-diol (PubChem CID 67615221) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 5,5-dimethylcyclohexene-1,3-diol.
| Compound Name | 5,5-dimethylcyclohexene-1,3-diol |
|---|---|
| PubChem CID | 67615221 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 5,5-dimethylcyclohexene-1,3-diol |
| SMILES | CC1(C)CC(O)=CC(O)C1 |
| InChI | InChI=1S/C8H14O2/c1-8(2)4-6(9)3-7(10)5-8/h3,6,9-10H,4-5H2,1-2H3 |
| InChIKey | UMNKNGOBLYWWIA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |