C17H13Cl3N2O2 — CID 67615557
3-(2,3-dihydroindol-1-yl)-3-oxo-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 67615557) has the molecular formula C17H13Cl3N2O2 and a molecular weight of 383.66 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-3-oxo-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-3-oxo-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 67615557 |
| Molecular Formula | C17H13Cl3N2O2 |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-3-oxo-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | O=C(CC(=O)N1CCc2ccccc21)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl3N2O2/c18-11-7-13(20)14(8-12(11)19)21-16(23)9-17(24)22-6-5-10-3-1-2-4-15(10)22/h1-4,7-8H,5-6,9H2,(H,21,23) |
| InChIKey | KCDZSNUINHTSKG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|