C24H28ClN3OS — CID 67616152
8-ethyl-N-prop-2-enyl-4-(2-propylsulfanylanilino)quinoline-3-carboxamide;hydrochloride (PubChem CID 67616152) has the molecular formula C24H28ClN3OS and a molecular weight of 442.03 g/mol. Its IUPAC name is 8-ethyl-N-prop-2-enyl-4-(2-propylsulfanylanilino)quinoline-3-carboxamide;hydrochloride.
| Compound Name | 8-ethyl-N-prop-2-enyl-4-(2-propylsulfanylanilino)quinoline-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67616152 |
| Molecular Formula | C24H28ClN3OS |
| Molecular Weight | 442.03 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 8-ethyl-N-prop-2-enyl-4-(2-propylsulfanylanilino)quinoline-3-carboxamide;hydrochloride |
| SMILES | C=CCNC(=O)c1cnc2c(CC)cccc2c1Nc1ccccc1SCCC.Cl |
| InChI | InChI=1S/C24H27N3OS.ClH/c1-4-14-25-24(28)19-16-26-22-17(6-3)10-9-11-18(22)23(19)27-20-12-7-8-13-21(20)29-15-5-2;/h4,7-13,16H,1,5-6,14-15H2,2-3H3,(H,25,28)(H,26,27);1H |
| InChIKey | QCNMJBWONNIGQL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.03 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|