C18H20ClNO4S2 — CID 67616832
1-[5-chloro-2-(4-methylsulfanylphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;oxalic acid (PubChem CID 67616832) has the molecular formula C18H20ClNO4S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 1-[5-chloro-2-(4-methylsulfanylphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;oxalic acid.
| Compound Name | 1-[5-chloro-2-(4-methylsulfanylphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;oxalic acid |
|---|---|
| PubChem CID | 67616832 |
| Molecular Formula | C18H20ClNO4S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 1-[5-chloro-2-(4-methylsulfanylphenyl)sulfanylphenyl]-N,N-dimethylmethanamine;oxalic acid |
| SMILES | CSc1ccc(Sc2ccc(Cl)cc2CN(C)C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H18ClNS2.C2H2O4/c1-18(2)11-12-10-13(17)4-9-16(12)20-15-7-5-14(19-3)6-8-15;3-1(4)2(5)6/h4-10H,11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | BJFABDJORWGWAA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|