C19H19F2NO4S — CID 67633163
but-2-enedioic acid;1-[5-fluoro-2-(3-fluorophenyl)sulfanylphenyl]-N,N-dimethylmethanamine (PubChem CID 67633163) has the molecular formula C19H19F2NO4S and a molecular weight of 395.43 g/mol. Its IUPAC name is but-2-enedioic acid;1-[5-fluoro-2-(3-fluorophenyl)sulfanylphenyl]-N,N-dimethylmethanamine.
| Compound Name | but-2-enedioic acid;1-[5-fluoro-2-(3-fluorophenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 67633163 |
| Molecular Formula | C19H19F2NO4S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | but-2-enedioic acid;1-[5-fluoro-2-(3-fluorophenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cc(F)ccc1Sc1cccc(F)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H15F2NS.C4H4O4/c1-18(2)10-11-8-13(17)6-7-15(11)19-14-5-3-4-12(16)9-14;5-3(6)1-2-4(7)8/h3-9H,10H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | PBTFRZSTIIVRGT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|