C19H16F4N2O5 — CID 67617891
ethyl 6,7-bis[(1R,2S)-1,2-difluorocyclopropyl]-8-methyl-5-nitro-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 67617891) has the molecular formula C19H16F4N2O5 and a molecular weight of 428.34 g/mol. Its IUPAC name is ethyl 6,7-bis[(1R,2S)-1,2-difluorocyclopropyl]-8-methyl-5-nitro-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 6,7-bis[(1R,2S)-1,2-difluorocyclopropyl]-8-methyl-5-nitro-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 67617891 |
| Molecular Formula | C19H16F4N2O5 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | ethyl 6,7-bis[(1R,2S)-1,2-difluorocyclopropyl]-8-methyl-5-nitro-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2c(C)c([C@]3(F)C[C@@H]3F)c([C@]3(F)C[C@@H]3F)c([N+](=O)[O-])c2c1=O |
| InChI | InChI=1S/C19H16F4N2O5/c1-3-30-17(27)8-6-24-14-7(2)12(18(22)4-9(18)20)13(19(23)5-10(19)21)15(25(28)29)11(14)16(8)26/h6,9-10H,3-5H2,1-2H3,(H,24,26)/t9-,10-,18-,19-/m0/s1 |
| InChIKey | UDXXOHOWGNRAJE-HHGXJENYSA-N |
| XLogP | 3.73 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|