C16H21FN4O3 — CID 67622782
N-[[3-[4-(2-fluoropiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 67622782) has the molecular formula C16H21FN4O3 and a molecular weight of 336.37 g/mol. Its IUPAC name is N-[[3-[4-(2-fluoropiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-(2-fluoropiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 67622782 |
| Molecular Formula | C16H21FN4O3 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[[3-[4-(2-fluoropiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCNCC3F)cc2)C(=O)O1 |
| InChI | InChI=1S/C16H21FN4O3/c1-11(22)19-8-14-10-21(16(23)24-14)13-4-2-12(3-5-13)20-7-6-18-9-15(20)17/h2-5,14-15,18H,6-10H2,1H3,(H,19,22) |
| InChIKey | PZPPDVXCJICVDP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|