C16H20FN3O4 — CID 66700399
N-[[3-[3-[(3S)-3-fluoromorpholin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 66700399) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is N-[[3-[3-[(3S)-3-fluoromorpholin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-[(3S)-3-fluoromorpholin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 66700399 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[[3-[3-[(3S)-3-fluoromorpholin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2cccc(N3CCOC[C@@H]3F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H20FN3O4/c1-11(21)18-8-14-9-20(16(22)24-14)13-4-2-3-12(7-13)19-5-6-23-10-15(19)17/h2-4,7,14-15H,5-6,8-10H2,1H3,(H,18,21)/t14?,15-/m1/s1 |
| InChIKey | ROAALXKVOXZNKS-YSSOQSIOSA-N |
| XLogP | 1.28 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|