C28H40N2O10 — CID 67625832
bis[(1R)-1-(3,4-dihydroxyphenyl)-2-(4-methoxybutan-2-ylamino)ethyl] oxalate (PubChem CID 67625832) has the molecular formula C28H40N2O10 and a molecular weight of 564.63 g/mol. Its IUPAC name is bis[(1R)-1-(3,4-dihydroxyphenyl)-2-(4-methoxybutan-2-ylamino)ethyl] oxalate.
| Compound Name | bis[(1R)-1-(3,4-dihydroxyphenyl)-2-(4-methoxybutan-2-ylamino)ethyl] oxalate |
|---|---|
| PubChem CID | 67625832 |
| Molecular Formula | C28H40N2O10 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | bis[(1R)-1-(3,4-dihydroxyphenyl)-2-(4-methoxybutan-2-ylamino)ethyl] oxalate |
| SMILES | COCCC(C)NC[C@H](OC(=O)C(=O)O[C@@H](CNC(C)CCOC)c1ccc(O)c(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C28H40N2O10/c1-17(9-11-37-3)29-15-25(19-5-7-21(31)23(33)13-19)39-27(35)28(36)40-26(16-30-18(2)10-12-38-4)20-6-8-22(32)24(34)14-20/h5-8,13-14,17-18,25-26,29-34H,9-12,15-16H2,1-4H3/t17?,18?,25-,26-/m0/s1 |
| InChIKey | UETNWYKNQNCJAZ-NLRAZLJFSA-N |
| XLogP | 2.41 |
| TPSA | 176.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|