C31H30N2O7 — CID 67626401
7-(2,2-dimethylpropanoyloxymethyl)-2-ethyl-3-[[4-(2-oxalophenyl)phenyl]methyl]benzimidazole-4-carboxylic acid (PubChem CID 67626401) has the molecular formula C31H30N2O7 and a molecular weight of 542.59 g/mol. Its IUPAC name is 7-(2,2-dimethylpropanoyloxymethyl)-2-ethyl-3-[[4-(2-oxalophenyl)phenyl]methyl]benzimidazole-4-carboxylic acid.
| Compound Name | 7-(2,2-dimethylpropanoyloxymethyl)-2-ethyl-3-[[4-(2-oxalophenyl)phenyl]methyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67626401 |
| Molecular Formula | C31H30N2O7 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 7-(2,2-dimethylpropanoyloxymethyl)-2-ethyl-3-[[4-(2-oxalophenyl)phenyl]methyl]benzimidazole-4-carboxylic acid |
| SMILES | CCc1nc2c(COC(=O)C(C)(C)C)ccc(C(=O)O)c2n1Cc1ccc(-c2ccccc2C(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C31H30N2O7/c1-5-24-32-25-20(17-40-30(39)31(2,3)4)14-15-23(28(35)36)26(25)33(24)16-18-10-12-19(13-11-18)21-8-6-7-9-22(21)27(34)29(37)38/h6-15H,5,16-17H2,1-4H3,(H,35,36)(H,37,38) |
| InChIKey | XAZBNDYUSWZHNI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|