C25H26N2O3S — CID 67629177
10-methyl-N-(4-methylphenyl)sulfonyl-N-propan-2-yl-9H-acridine-1-carboxamide (PubChem CID 67629177) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 10-methyl-N-(4-methylphenyl)sulfonyl-N-propan-2-yl-9H-acridine-1-carboxamide.
| Compound Name | 10-methyl-N-(4-methylphenyl)sulfonyl-N-propan-2-yl-9H-acridine-1-carboxamide |
|---|---|
| PubChem CID | 67629177 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 10-methyl-N-(4-methylphenyl)sulfonyl-N-propan-2-yl-9H-acridine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)c2cccc3c2Cc2ccccc2N3C)C(C)C)cc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-17(2)27(31(29,30)20-14-12-18(3)13-15-20)25(28)21-9-7-11-24-22(21)16-19-8-5-6-10-23(19)26(24)4/h5-15,17H,16H2,1-4H3 |
| InChIKey | HQHJJGAMWCYMFW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |