C27H28N2O3 — CID 67629471
4-[1-(4-nitrophenyl)butyl]-N-propyl-9H-fluorene-9-carboxamide (PubChem CID 67629471) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-[1-(4-nitrophenyl)butyl]-N-propyl-9H-fluorene-9-carboxamide.
| Compound Name | 4-[1-(4-nitrophenyl)butyl]-N-propyl-9H-fluorene-9-carboxamide |
|---|---|
| PubChem CID | 67629471 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-[1-(4-nitrophenyl)butyl]-N-propyl-9H-fluorene-9-carboxamide |
| SMILES | CCCNC(=O)C1c2ccccc2-c2c(C(CCC)c3ccc([N+](=O)[O-])cc3)cccc21 |
| InChI | InChI=1S/C27H28N2O3/c1-3-8-20(18-13-15-19(16-14-18)29(31)32)21-11-7-12-24-25(21)22-9-5-6-10-23(22)26(24)27(30)28-17-4-2/h5-7,9-16,20,26H,3-4,8,17H2,1-2H3,(H,28,30) |
| InChIKey | ITPZVHUEEIASOR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|