About pyridine-4-carboxamide
pyridine-4-carboxamide (PubChem CID 67631168) has the molecular formula C12H12N4O2
and a molecular weight of 244.25 g/mol. Its IUPAC name is pyridine-4-carboxamide.
Molecular Properties
| Compound Name | pyridine-4-carboxamide |
| PubChem CID | 67631168 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccncc1.NC(=O)c1ccncc1 |
| InChI | InChI=1S/2C6H6N2O/c2*7-6(9)5-1-3-8-4-2-5/h2*1-4H,(H2,7,9) |
| InChIKey | UZFKIHMFDWGBKC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-4-carboxamide?
The IUPAC name of pyridine-4-carboxamide (CID 67631168) is pyridine-4-carboxamide.
What is the SMILES notation for pyridine-4-carboxamide?
The canonical SMILES for pyridine-4-carboxamide is NC(=O)c1ccncc1.NC(=O)c1ccncc1.
What is the InChIKey of pyridine-4-carboxamide?
The InChIKey is UZFKIHMFDWGBKC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6N2O/c2*7-6(9)5-1-3-8-4-2-5/h2*1-4H,(H2,7,9).
What are the key properties of pyridine-4-carboxamide?
pyridine-4-carboxamide has a molecular weight of 244.25 g/mol, XLogP of 0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-4-carboxamide is sourced from PubChem (CID 67631168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).