C16H32N2Si2 — CID 67633576
N-[[(2Z,4Z)-6-[dimethylamino(dimethyl)silyl]cycloocta-2,4,7-trien-1-yl]-dimethylsilyl]-N-methylmethanamine (PubChem CID 67633576) has the molecular formula C16H32N2Si2 and a molecular weight of 308.62 g/mol. Its IUPAC name is N-[[(2Z,4Z)-6-[dimethylamino(dimethyl)silyl]cycloocta-2,4,7-trien-1-yl]-dimethylsilyl]-N-methylmethanamine.
| Compound Name | N-[[(2Z,4Z)-6-[dimethylamino(dimethyl)silyl]cycloocta-2,4,7-trien-1-yl]-dimethylsilyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 67633576 |
| Molecular Formula | C16H32N2Si2 |
| Molecular Weight | 308.62 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | N-[[(2Z,4Z)-6-[dimethylamino(dimethyl)silyl]cycloocta-2,4,7-trien-1-yl]-dimethylsilyl]-N-methylmethanamine |
| SMILES | CN(C)[Si](C)(C)C1C=CC([Si](C)(C)N(C)C)/C=C\C=C/1 |
| InChI | InChI=1S/C16H32N2Si2/c1-17(2)19(5,6)15-11-9-10-12-16(14-13-15)20(7,8)18(3)4/h9-16H,1-8H3/b11-9-,12-10-,14-13? |
| InChIKey | TVCQKESGGPJJLI-WAIHQSJWSA-N |
| XLogP | 3.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|