C21H23FIN3O3 — CID 67634105
N-[[1-[(6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]-2-iodopiperidin-4-yl]methyl]pyridine-3-carboxamide (PubChem CID 67634105) has the molecular formula C21H23FIN3O3 and a molecular weight of 511.34 g/mol. Its IUPAC name is N-[[1-[(6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]-2-iodopiperidin-4-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[1-[(6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]-2-iodopiperidin-4-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67634105 |
| Molecular Formula | C21H23FIN3O3 |
| Molecular Weight | 511.34 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | N-[[1-[(6-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]-2-iodopiperidin-4-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCN(CC2COc3ccc(F)cc3O2)C(I)C1)c1cccnc1 |
| InChI | InChI=1S/C21H23FIN3O3/c22-16-3-4-18-19(9-16)29-17(13-28-18)12-26-7-5-14(8-20(26)23)10-25-21(27)15-2-1-6-24-11-15/h1-4,6,9,11,14,17,20H,5,7-8,10,12-13H2,(H,25,27) |
| InChIKey | HRQOHDHVMKFURX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|