C22H31N3O — CID 67634741
9-amino-N-cyclohexyl-6-propyl-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 67634741) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 9-amino-N-cyclohexyl-6-propyl-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 9-amino-N-cyclohexyl-6-propyl-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 67634741 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 9-amino-N-cyclohexyl-6-propyl-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CCCC1CCc2c(c3cc(C(=O)NC4CCCCC4)ccc3n2N)C1 |
| InChI | InChI=1S/C22H31N3O/c1-2-6-15-9-11-20-18(13-15)19-14-16(10-12-21(19)25(20)23)22(26)24-17-7-4-3-5-8-17/h10,12,14-15,17H,2-9,11,13,23H2,1H3,(H,24,26) |
| InChIKey | ITAKSCWIMJSHFF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |