C24H33F2N5O — CID 67635865
4-N-[5-fluoro-4-[6-fluoro-5-[(1-methylcyclopropyl)methylamino]-3-pyridinyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine (PubChem CID 67635865) has the molecular formula C24H33F2N5O and a molecular weight of 445.56 g/mol. Its IUPAC name is 4-N-[5-fluoro-4-[6-fluoro-5-[(1-methylcyclopropyl)methylamino]-3-pyridinyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-[5-fluoro-4-[6-fluoro-5-[(1-methylcyclopropyl)methylamino]-3-pyridinyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 67635865 |
| Molecular Formula | C24H33F2N5O |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 4-N-[5-fluoro-4-[6-fluoro-5-[(1-methylcyclopropyl)methylamino]-3-pyridinyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine |
| SMILES | COCCNC1CCC(Nc2cc(-c3cnc(F)c(NCC4(C)CC4)c3)c(F)cn2)CC1 |
| InChI | InChI=1S/C24H33F2N5O/c1-24(7-8-24)15-30-21-11-16(13-29-23(21)26)19-12-22(28-14-20(19)25)31-18-5-3-17(4-6-18)27-9-10-32-2/h11-14,17-18,27,30H,3-10,15H2,1-2H3,(H,28,31) |
| InChIKey | KMNKWJYIQNPAOI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|